C18H25N3O3 — CID 132517430
(3S)-2-benzyl-3-methyl-6-propoxy-6,7,8,9-tetrahydro-3H-pyridazino[1,2-a][1,2,4]triazine-1,4-dione (PubChem CID 132517430) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is (3S)-2-benzyl-3-methyl-6-propoxy-6,7,8,9-tetrahydro-3H-pyridazino[1,2-a][1,2,4]triazine-1,4-dione.
| Compound Name | (3S)-2-benzyl-3-methyl-6-propoxy-6,7,8,9-tetrahydro-3H-pyridazino[1,2-a][1,2,4]triazine-1,4-dione |
|---|---|
| PubChem CID | 132517430 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (3S)-2-benzyl-3-methyl-6-propoxy-6,7,8,9-tetrahydro-3H-pyridazino[1,2-a][1,2,4]triazine-1,4-dione |
| SMILES | CCCOC1CCCN2C(=O)N(Cc3ccccc3)[C@@H](C)C(=O)N12 |
| InChI | InChI=1S/C18H25N3O3/c1-3-12-24-16-10-7-11-20-18(23)19(14(2)17(22)21(16)20)13-15-8-5-4-6-9-15/h4-6,8-9,14,16H,3,7,10-13H2,1-2H3/t14-,16?/m0/s1 |
| InChIKey | WRGOKVKPVRLGEU-LBAUFKAWSA-N |
| XLogP | 2.60 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |