C21H10N4O4S — CID 132517705
11-(4-nitrophenyl)-20-oxa-5-thia-3,8,12-triazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2(10),3,6,11,14,16,18-octaen-9-one (PubChem CID 132517705) has the molecular formula C21H10N4O4S and a molecular weight of 414.40 g/mol. Its IUPAC name is 11-(4-nitrophenyl)-20-oxa-5-thia-3,8,12-triazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2(10),3,6,11,14,16,18-octaen-9-one.
| Compound Name | 11-(4-nitrophenyl)-20-oxa-5-thia-3,8,12-triazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2(10),3,6,11,14,16,18-octaen-9-one |
|---|---|
| PubChem CID | 132517705 |
| Molecular Formula | C21H10N4O4S |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 11-(4-nitrophenyl)-20-oxa-5-thia-3,8,12-triazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2(10),3,6,11,14,16,18-octaen-9-one |
| SMILES | O=c1c2c(-c3ccc([N+](=O)[O-])cc3)nc3c4ccccc4oc3c2nc2sccn12 |
| InChI | InChI=1S/C21H10N4O4S/c26-20-15-16(11-5-7-12(8-6-11)25(27)28)22-17-13-3-1-2-4-14(13)29-19(17)18(15)23-21-24(20)9-10-30-21/h1-10H |
| InChIKey | NWGIRNGOPVNFLI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 103.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|