About (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,3-oxazolidin-2-one
(5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,3-oxazolidin-2-one (PubChem CID 132517853) has the molecular formula C12H23NO3Si
and a molecular weight of 257.41 g/mol. Its IUPAC name is (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,3-oxazolidin-2-one |
| PubChem CID | 132517853 |
| Molecular Formula | C12H23NO3Si |
| Molecular Weight | 257.41 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/[C@@H]1CNC(=O)O1 |
| InChI | InChI=1S/C12H23NO3Si/c1-12(2,3)17(4,5)15-8-6-7-10-9-13-11(14)16-10/h6-7,10H,8-9H2,1-5H3,(H,13,14)/b7-6+/t10-/m1/s1 |
| InChIKey | AQOAOGWJXQUGDH-VQCYPWCPSA-N |
| XLogP | 2.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,3-oxazolidin-2-one?
The IUPAC name of (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,3-oxazolidin-2-one (CID 132517853) is (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,3-oxazolidin-2-one?
The canonical SMILES for (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,3-oxazolidin-2-one is CC(C)(C)[Si](C)(C)OC/C=C/[C@@H]1CNC(=O)O1.
What is the InChIKey of (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,3-oxazolidin-2-one?
The InChIKey is AQOAOGWJXQUGDH-VQCYPWCPSA-N. The full InChI is InChI=1S/C12H23NO3Si/c1-12(2,3)17(4,5)15-8-6-7-10-9-13-11(14)16-10/h6-7,10H,8-9H2,1-5H3,(H,13,14)/b7-6+/t10-/m1/s1.
What are the key properties of (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,3-oxazolidin-2-one?
(5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,3-oxazolidin-2-one has a molecular weight of 257.41 g/mol, XLogP of 2.67, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 132517853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).