C25H22F2O — CID 132517954
(1R,4aS,10S,10aS)-1-(3,5-difluorophenyl)-10-phenyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[g]isochromene (PubChem CID 132517954) has the molecular formula C25H22F2O and a molecular weight of 376.45 g/mol. Its IUPAC name is (1R,4aS,10S,10aS)-1-(3,5-difluorophenyl)-10-phenyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[g]isochromene.
| Compound Name | (1R,4aS,10S,10aS)-1-(3,5-difluorophenyl)-10-phenyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[g]isochromene |
|---|---|
| PubChem CID | 132517954 |
| Molecular Formula | C25H22F2O |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (1R,4aS,10S,10aS)-1-(3,5-difluorophenyl)-10-phenyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[g]isochromene |
| SMILES | Fc1cc(F)cc([C@@H]2OCC[C@@H]3Cc4ccccc4[C@H](c4ccccc4)[C@H]32)c1 |
| InChI | InChI=1S/C25H22F2O/c26-20-13-19(14-21(27)15-20)25-24-18(10-11-28-25)12-17-8-4-5-9-22(17)23(24)16-6-2-1-3-7-16/h1-9,13-15,18,23-25H,10-12H2/t18-,23+,24+,25+/m1/s1 |
| InChIKey | WRGNCUFKWANBIH-DNQHQPOYSA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |