About 1,8-dimethoxyoctane-2,4,7-trione
1,8-dimethoxyoctane-2,4,7-trione (PubChem CID 132518011) has the molecular formula C10H16O5
and a molecular weight of 216.23 g/mol. Its IUPAC name is 1,8-dimethoxyoctane-2,4,7-trione.
Molecular Properties
| Compound Name | 1,8-dimethoxyoctane-2,4,7-trione |
| PubChem CID | 132518011 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1,8-dimethoxyoctane-2,4,7-trione |
| SMILES | COCC(=O)CCC(=O)CC(=O)COC |
| InChI | InChI=1S/C10H16O5/c1-14-6-9(12)4-3-8(11)5-10(13)7-15-2/h3-7H2,1-2H3 |
| InChIKey | BIKPIEYHSSOBPZ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1,8-dimethoxyoctane-2,4,7-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dimethoxyoctane-2,4,7-trione?
The IUPAC name of 1,8-dimethoxyoctane-2,4,7-trione (CID 132518011) is 1,8-dimethoxyoctane-2,4,7-trione.
What is the SMILES notation for 1,8-dimethoxyoctane-2,4,7-trione?
The canonical SMILES for 1,8-dimethoxyoctane-2,4,7-trione is COCC(=O)CCC(=O)CC(=O)COC.
What is the InChIKey of 1,8-dimethoxyoctane-2,4,7-trione?
The InChIKey is BIKPIEYHSSOBPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O5/c1-14-6-9(12)4-3-8(11)5-10(13)7-15-2/h3-7H2,1-2H3.
What are the key properties of 1,8-dimethoxyoctane-2,4,7-trione?
1,8-dimethoxyoctane-2,4,7-trione has a molecular weight of 216.23 g/mol, XLogP of 0.16, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dimethoxyoctane-2,4,7-trione is sourced from PubChem (CID 132518011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).