C28H33F3N2O5 — CID 132518197
tert-butyl 3-[2-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl)ethyl]-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate (PubChem CID 132518197) has the molecular formula C28H33F3N2O5 and a molecular weight of 534.58 g/mol. Its IUPAC name is tert-butyl 3-[2-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl)ethyl]-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate.
| Compound Name | tert-butyl 3-[2-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl)ethyl]-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
|---|---|
| PubChem CID | 132518197 |
| Molecular Formula | C28H33F3N2O5 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | tert-butyl 3-[2-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl)ethyl]-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
| SMILES | C=CC(CCc1cc(=O)oc2c3c4c(cc12)CCCN4CCC3)C(NC(=O)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H33F3N2O5/c1-5-16(22(25(35)38-27(2,3)4)32-26(36)28(29,30)31)10-11-17-15-21(34)37-24-19-9-7-13-33-12-6-8-18(23(19)33)14-20(17)24/h5,14-16,22H,1,6-13H2,2-4H3,(H,32,36) |
| InChIKey | RHKMJHKWBODYST-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|