C17H13BrO4S — CID 132518621
(5-bromo-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-3-yl) 4-methylbenzenesulfonate (PubChem CID 132518621) has the molecular formula C17H13BrO4S and a molecular weight of 393.26 g/mol. Its IUPAC name is (5-bromo-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-3-yl) 4-methylbenzenesulfonate.
| Compound Name | (5-bromo-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-3-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 132518621 |
| Molecular Formula | C17H13BrO4S |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | (5-bromo-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-3-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cc(Br)cc3c2C2C=CC3O2)cc1 |
| InChI | InChI=1S/C17H13BrO4S/c1-10-2-4-12(5-3-10)23(19,20)22-16-9-11(18)8-13-14-6-7-15(21-14)17(13)16/h2-9,14-15H,1H3 |
| InChIKey | GBPSVCJEOWGHSS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|