C24H26N2O — CID 132518668
3-[(5S,7R)-2-(4-methoxyphenyl)-1-adamantyl]imidazo[1,5-a]pyridine (PubChem CID 132518668) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is 3-[(5S,7R)-2-(4-methoxyphenyl)-1-adamantyl]imidazo[1,5-a]pyridine.
| Compound Name | 3-[(5S,7R)-2-(4-methoxyphenyl)-1-adamantyl]imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 132518668 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 3-[(5S,7R)-2-(4-methoxyphenyl)-1-adamantyl]imidazo[1,5-a]pyridine |
| SMILES | COc1ccc(C2C3C[C@@H]4C[C@H](C3)CC2(c2ncc3ccccn23)C4)cc1 |
| InChI | InChI=1S/C24H26N2O/c1-27-21-7-5-18(6-8-21)22-19-11-16-10-17(12-19)14-24(22,13-16)23-25-15-20-4-2-3-9-26(20)23/h2-9,15-17,19,22H,10-14H2,1H3/t16-,17+,19?,22?,24? |
| InChIKey | ALZGXMAZLZJIMZ-UBXVPBCRSA-N |
| XLogP | 5.20 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |