About 1-[2-butyl-4,4-bis(trifluoromethylsulfonyl)cyclobuten-1-yl]-4-methoxybenzene
1-[2-butyl-4,4-bis(trifluoromethylsulfonyl)cyclobuten-1-yl]-4-methoxybenzene (PubChem CID 132519118) has the molecular formula C17H18F6O5S2
and a molecular weight of 480.45 g/mol. Its IUPAC name is 1-[2-butyl-4,4-bis(trifluoromethylsulfonyl)cyclobuten-1-yl]-4-methoxybenzene.
Molecular Properties
| Compound Name | 1-[2-butyl-4,4-bis(trifluoromethylsulfonyl)cyclobuten-1-yl]-4-methoxybenzene |
| PubChem CID | 132519118 |
| Molecular Formula | C17H18F6O5S2 |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 1-[2-butyl-4,4-bis(trifluoromethylsulfonyl)cyclobuten-1-yl]-4-methoxybenzene |
| SMILES | CCCCC1=C(c2ccc(OC)cc2)C(S(=O)(=O)C(F)(F)F)(S(=O)(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C17H18F6O5S2/c1-3-4-5-12-10-15(29(24,25)16(18,19)20,30(26,27)17(21,22)23)14(12)11-6-8-13(28-2)9-7-11/h6-9H,3-5,10H2,1-2H3 |
| InChIKey | JVJSTRKRATYWQT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-butyl-4,4-bis(trifluoromethylsulfonyl)cyclobuten-1-yl]-4-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-butyl-4,4-bis(trifluoromethylsulfonyl)cyclobuten-1-yl]-4-methoxybenzene?
The IUPAC name of 1-[2-butyl-4,4-bis(trifluoromethylsulfonyl)cyclobuten-1-yl]-4-methoxybenzene (CID 132519118) is 1-[2-butyl-4,4-bis(trifluoromethylsulfonyl)cyclobuten-1-yl]-4-methoxybenzene.
What is the SMILES notation for 1-[2-butyl-4,4-bis(trifluoromethylsulfonyl)cyclobuten-1-yl]-4-methoxybenzene?
The canonical SMILES for 1-[2-butyl-4,4-bis(trifluoromethylsulfonyl)cyclobuten-1-yl]-4-methoxybenzene is CCCCC1=C(c2ccc(OC)cc2)C(S(=O)(=O)C(F)(F)F)(S(=O)(=O)C(F)(F)F)C1.
What is the InChIKey of 1-[2-butyl-4,4-bis(trifluoromethylsulfonyl)cyclobuten-1-yl]-4-methoxybenzene?
The InChIKey is JVJSTRKRATYWQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F6O5S2/c1-3-4-5-12-10-15(29(24,25)16(18,19)20,30(26,27)17(21,22)23)14(12)11-6-8-13(28-2)9-7-11/h6-9H,3-5,10H2,1-2H3.
What are the key properties of 1-[2-butyl-4,4-bis(trifluoromethylsulfonyl)cyclobuten-1-yl]-4-methoxybenzene?
1-[2-butyl-4,4-bis(trifluoromethylsulfonyl)cyclobuten-1-yl]-4-methoxybenzene has a molecular weight of 480.45 g/mol, XLogP of 4.61, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-butyl-4,4-bis(trifluoromethylsulfonyl)cyclobuten-1-yl]-4-methoxybenzene is sourced from PubChem (CID 132519118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).