C15H22O5 — CID 132519289
(5R,5aS,6S,9aR)-5-hydroxy-6,9a-bis(hydroxymethyl)-6-methyl-4,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-3-one (PubChem CID 132519289) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (5R,5aS,6S,9aR)-5-hydroxy-6,9a-bis(hydroxymethyl)-6-methyl-4,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-3-one.
| Compound Name | (5R,5aS,6S,9aR)-5-hydroxy-6,9a-bis(hydroxymethyl)-6-methyl-4,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-3-one |
|---|---|
| PubChem CID | 132519289 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (5R,5aS,6S,9aR)-5-hydroxy-6,9a-bis(hydroxymethyl)-6-methyl-4,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-3-one |
| SMILES | C[C@]1(CO)CCC[C@]2(CO)C3=C(C[C@@H](O)[C@@H]12)C(=O)OC3 |
| InChI | InChI=1S/C15H22O5/c1-14(7-16)3-2-4-15(8-17)10-6-20-13(19)9(10)5-11(18)12(14)15/h11-12,16-18H,2-8H2,1H3/t11-,12+,14-,15+/m1/s1 |
| InChIKey | HNUDWMWACNXTIF-OSRDXIQISA-N |
| XLogP | 0.38 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |