C17H25NO — CID 132519399
2-(4-octylphenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 132519399) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-(4-octylphenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(4-octylphenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 132519399 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-(4-octylphenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCCCc1ccc(C2=NCCO2)cc1 |
| InChI | InChI=1S/C17H25NO/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)17-18-13-14-19-17/h9-12H,2-8,13-14H2,1H3 |
| InChIKey | QIZVHNATKXIRJW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|