C19H29NO — CID 132519401
2-(4-Decylphenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 132519401) has the molecular formula C19H29NO and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-(4-decylphenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(4-Decylphenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 132519401 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 2-(4-decylphenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCCCCCC1=CC=C(C=C1)C2=NCCO2 |
| InChI | InChI=1S/C19H29NO/c1-2-3-4-5-6-7-8-9-10-17-11-13-18(14-12-17)19-20-15-16-21-19/h11-14H,2-10,15-16H2,1H3 |
| InChIKey | WNYYSXNKYWRAQE-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 21.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | 292 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|