C23H23N5S2 — CID 132519535
4-[6-(2-amino-1,3-thiazol-4-yl)-9-pentylcarbazol-3-yl]-1,3-thiazol-2-amine (PubChem CID 132519535) has the molecular formula C23H23N5S2 and a molecular weight of 433.61 g/mol. Its IUPAC name is 4-[6-(2-amino-1,3-thiazol-4-yl)-9-pentylcarbazol-3-yl]-1,3-thiazol-2-amine.
| Compound Name | 4-[6-(2-amino-1,3-thiazol-4-yl)-9-pentylcarbazol-3-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 132519535 |
| Molecular Formula | C23H23N5S2 |
| Molecular Weight | 433.61 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 4-[6-(2-amino-1,3-thiazol-4-yl)-9-pentylcarbazol-3-yl]-1,3-thiazol-2-amine |
| SMILES | CCCCCn1c2ccc(-c3csc(N)n3)cc2c2cc(-c3csc(N)n3)ccc21 |
| InChI | InChI=1S/C23H23N5S2/c1-2-3-4-9-28-20-7-5-14(18-12-29-22(24)26-18)10-16(20)17-11-15(6-8-21(17)28)19-13-30-23(25)27-19/h5-8,10-13H,2-4,9H2,1H3,(H2,24,26)(H2,25,27) |
| InChIKey | HITLBPSURJLQGM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.61 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|