About (3S)-5-chloro-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,5'-cyclopent-2-ene]-1'-one
(3S)-5-chloro-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,5'-cyclopent-2-ene]-1'-one (PubChem CID 132519746) has the molecular formula C19H16ClNO3S
and a molecular weight of 373.86 g/mol. Its IUPAC name is (3S)-5-chloro-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,5'-cyclopent-2-ene]-1'-one.
Molecular Properties
| Compound Name | (3S)-5-chloro-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,5'-cyclopent-2-ene]-1'-one |
| PubChem CID | 132519746 |
| Molecular Formula | C19H16ClNO3S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | (3S)-5-chloro-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,5'-cyclopent-2-ene]-1'-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@]3(CC=CC3=O)c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C19H16ClNO3S/c1-13-4-7-15(8-5-13)25(23,24)21-12-19(10-2-3-18(19)22)16-11-14(20)6-9-17(16)21/h2-9,11H,10,12H2,1H3/t19-/m1/s1 |
| InChIKey | PIMCWVQZFAQKDJ-LJQANCHMSA-N |
| XLogP | 3.62 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-5-chloro-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,5'-cyclopent-2-ene]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5-chloro-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,5'-cyclopent-2-ene]-1'-one?
The IUPAC name of (3S)-5-chloro-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,5'-cyclopent-2-ene]-1'-one (CID 132519746) is (3S)-5-chloro-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,5'-cyclopent-2-ene]-1'-one.
What is the SMILES notation for (3S)-5-chloro-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,5'-cyclopent-2-ene]-1'-one?
The canonical SMILES for (3S)-5-chloro-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,5'-cyclopent-2-ene]-1'-one is Cc1ccc(S(=O)(=O)N2C[C@]3(CC=CC3=O)c3cc(Cl)ccc32)cc1.
What is the InChIKey of (3S)-5-chloro-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,5'-cyclopent-2-ene]-1'-one?
The InChIKey is PIMCWVQZFAQKDJ-LJQANCHMSA-N. The full InChI is InChI=1S/C19H16ClNO3S/c1-13-4-7-15(8-5-13)25(23,24)21-12-19(10-2-3-18(19)22)16-11-14(20)6-9-17(16)21/h2-9,11H,10,12H2,1H3/t19-/m1/s1.
What are the key properties of (3S)-5-chloro-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,5'-cyclopent-2-ene]-1'-one?
(3S)-5-chloro-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,5'-cyclopent-2-ene]-1'-one has a molecular weight of 373.86 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5-chloro-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,5'-cyclopent-2-ene]-1'-one is sourced from PubChem (CID 132519746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).