C21H35NO — CID 132520039
N-[(2S,5E)-6,10-dimethyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]undeca-5,9-dien-2-yl]formamide (PubChem CID 132520039) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is N-[(2S,5E)-6,10-dimethyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]undeca-5,9-dien-2-yl]formamide.
| Compound Name | N-[(2S,5E)-6,10-dimethyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]undeca-5,9-dien-2-yl]formamide |
|---|---|
| PubChem CID | 132520039 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | N-[(2S,5E)-6,10-dimethyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]undeca-5,9-dien-2-yl]formamide |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@](C)(NC=O)[C@@H]1CC=C(C)CC1 |
| InChI | InChI=1S/C21H35NO/c1-17(2)8-6-9-18(3)10-7-15-21(5,22-16-23)20-13-11-19(4)12-14-20/h8,10-11,16,20H,6-7,9,12-15H2,1-5H3,(H,22,23)/b18-10+/t20-,21+/m1/s1 |
| InChIKey | DLDZBOBBKSTFIN-KYYLQIHLSA-N |
| XLogP | 5.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|