C18H10Cl5F2P — CID 132520088
difluoro-(2,3,4,5,6-pentachlorophenyl)-diphenyl-λ5-phosphane (PubChem CID 132520088) has the molecular formula C18H10Cl5F2P and a molecular weight of 472.51 g/mol. Its IUPAC name is difluoro-(2,3,4,5,6-pentachlorophenyl)-diphenyl-λ5-phosphane.
| Compound Name | difluoro-(2,3,4,5,6-pentachlorophenyl)-diphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 132520088 |
| Molecular Formula | C18H10Cl5F2P |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 469.89 |
| IUPAC Name | difluoro-(2,3,4,5,6-pentachlorophenyl)-diphenyl-λ5-phosphane |
| SMILES | FP(F)(c1ccccc1)(c1ccccc1)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C18H10Cl5F2P/c19-13-14(20)16(22)18(17(23)15(13)21)26(24,25,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | PMESXUFXLPXUOA-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|