C11H17F3O3S — CID 132520133
4-(2,2,2-trifluoroethyl)-2-oxa-3λ6-thiaspiro[5.5]undecane 3,3-dioxide (PubChem CID 132520133) has the molecular formula C11H17F3O3S and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethyl)-2-oxa-3λ6-thiaspiro[5.5]undecane 3,3-dioxide.
| Compound Name | 4-(2,2,2-trifluoroethyl)-2-oxa-3λ6-thiaspiro[5.5]undecane 3,3-dioxide |
|---|---|
| PubChem CID | 132520133 |
| Molecular Formula | C11H17F3O3S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 4-(2,2,2-trifluoroethyl)-2-oxa-3λ6-thiaspiro[5.5]undecane 3,3-dioxide |
| SMILES | O=S1(=O)OCC2(CCCCC2)CC1CC(F)(F)F |
| InChI | InChI=1S/C11H17F3O3S/c12-11(13,14)7-9-6-10(4-2-1-3-5-10)8-17-18(9,15)16/h9H,1-8H2 |
| InChIKey | LZZITRZXIAAUON-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|