C22H28O5 — CID 132520156
[(1R,2S,7S,8aR)-7-[(E)-1-methoxy-3-oxoprop-1-en-2-yl]-1,8a-dimethyl-6-oxo-1,2,7,8-tetrahydronaphthalen-2-yl] (E)-hex-4-enoate (PubChem CID 132520156) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is [(1R,2S,7S,8aR)-7-[(E)-1-methoxy-3-oxoprop-1-en-2-yl]-1,8a-dimethyl-6-oxo-1,2,7,8-tetrahydronaphthalen-2-yl] (E)-hex-4-enoate.
| Compound Name | [(1R,2S,7S,8aR)-7-[(E)-1-methoxy-3-oxoprop-1-en-2-yl]-1,8a-dimethyl-6-oxo-1,2,7,8-tetrahydronaphthalen-2-yl] (E)-hex-4-enoate |
|---|---|
| PubChem CID | 132520156 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | [(1R,2S,7S,8aR)-7-[(E)-1-methoxy-3-oxoprop-1-en-2-yl]-1,8a-dimethyl-6-oxo-1,2,7,8-tetrahydronaphthalen-2-yl] (E)-hex-4-enoate |
| SMILES | C/C=C/CCC(=O)O[C@H]1C=CC2=CC(=O)[C@H](/C(C=O)=C\OC)C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C22H28O5/c1-5-6-7-8-21(25)27-20-10-9-17-11-19(24)18(16(13-23)14-26-4)12-22(17,3)15(20)2/h5-6,9-11,13-15,18,20H,7-8,12H2,1-4H3/b6-5+,16-14-/t15-,18-,20-,22+/m0/s1 |
| InChIKey | WQQJVNUUYPMYIA-HNYOEMKWSA-N |
| XLogP | 3.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|