C17H24O3 — CID 132520161
[(2R,4S,4aR,6S)-4,4a-dimethyl-7-oxo-6-prop-1-en-2-yl-1,2,3,4,5,6-hexahydronaphthalen-2-yl] acetate (PubChem CID 132520161) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is [(2R,4S,4aR,6S)-4,4a-dimethyl-7-oxo-6-prop-1-en-2-yl-1,2,3,4,5,6-hexahydronaphthalen-2-yl] acetate.
| Compound Name | [(2R,4S,4aR,6S)-4,4a-dimethyl-7-oxo-6-prop-1-en-2-yl-1,2,3,4,5,6-hexahydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 132520161 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [(2R,4S,4aR,6S)-4,4a-dimethyl-7-oxo-6-prop-1-en-2-yl-1,2,3,4,5,6-hexahydronaphthalen-2-yl] acetate |
| SMILES | C=C(C)[C@@H]1C[C@@]2(C)C(=CC1=O)C[C@H](OC(C)=O)C[C@@H]2C |
| InChI | InChI=1S/C17H24O3/c1-10(2)15-9-17(5)11(3)6-14(20-12(4)18)7-13(17)8-16(15)19/h8,11,14-15H,1,6-7,9H2,2-5H3/t11-,14+,15-,17+/m0/s1 |
| InChIKey | WPCVCYGPRDXBPB-MQVNZCODSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|