C14H28O3Si — CID 132520568
6-[tert-butyl(dimethyl)silyl]oxy-2-ethenylhexanoic acid (PubChem CID 132520568) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-2-ethenylhexanoic acid.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-2-ethenylhexanoic acid |
|---|---|
| PubChem CID | 132520568 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-2-ethenylhexanoic acid |
| SMILES | C=CC(CCCCO[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H28O3Si/c1-7-12(13(15)16)10-8-9-11-17-18(5,6)14(2,3)4/h7,12H,1,8-11H2,2-6H3,(H,15,16) |
| InChIKey | MDRORGCWKYAELM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|