C16H24N8S — CID 132520942
1-ethyl-3-[6-[4-[(4-methylpiperazin-1-yl)methyl]imidazol-1-yl]pyrimidin-4-yl]thiourea (PubChem CID 132520942) has the molecular formula C16H24N8S and a molecular weight of 360.49 g/mol. Its IUPAC name is 1-ethyl-3-[6-[4-[(4-methylpiperazin-1-yl)methyl]imidazol-1-yl]pyrimidin-4-yl]thiourea.
| Compound Name | 1-ethyl-3-[6-[4-[(4-methylpiperazin-1-yl)methyl]imidazol-1-yl]pyrimidin-4-yl]thiourea |
|---|---|
| PubChem CID | 132520942 |
| Molecular Formula | C16H24N8S |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1-ethyl-3-[6-[4-[(4-methylpiperazin-1-yl)methyl]imidazol-1-yl]pyrimidin-4-yl]thiourea |
| SMILES | CCNC(=S)Nc1cc(-n2cnc(CN3CCN(C)CC3)c2)ncn1 |
| InChI | InChI=1S/C16H24N8S/c1-3-17-16(25)21-14-8-15(19-11-18-14)24-10-13(20-12-24)9-23-6-4-22(2)5-7-23/h8,10-12H,3-7,9H2,1-2H3,(H2,17,18,19,21,25) |
| InChIKey | HKYGYTXRCBZVKF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|