C18H13NO4 — CID 132521123
(3aR,9bS)-4-oxo-3-phenyl-1,9b-dihydrochromeno[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 132521123) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is (3aR,9bS)-4-oxo-3-phenyl-1,9b-dihydrochromeno[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,9bS)-4-oxo-3-phenyl-1,9b-dihydrochromeno[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 132521123 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (3aR,9bS)-4-oxo-3-phenyl-1,9b-dihydrochromeno[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)[C@@]12C(=O)Oc3ccccc3[C@@H]1CN=C2c1ccccc1 |
| InChI | InChI=1S/C18H13NO4/c20-16(21)18-13(10-19-15(18)11-6-2-1-3-7-11)12-8-4-5-9-14(12)23-17(18)22/h1-9,13H,10H2,(H,20,21)/t13-,18+/m0/s1 |
| InChIKey | XROHUCMPPPPESW-SCLBCKFNSA-N |
| XLogP | 2.26 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|