C13H13N3O5 — CID 132522237
5-[1-(4-methylphenyl)-2-nitroethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 132522237) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is 5-[1-(4-methylphenyl)-2-nitroethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[1-(4-methylphenyl)-2-nitroethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 132522237 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 5-[1-(4-methylphenyl)-2-nitroethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(C(C[N+](=O)[O-])C2C(=O)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C13H13N3O5/c1-7-2-4-8(5-3-7)9(6-16(20)21)10-11(17)14-13(19)15-12(10)18/h2-5,9-10H,6H2,1H3,(H2,14,15,17,18,19) |
| InChIKey | MVRROSJGAHHQTI-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|