C22H17ClO8 — CID 132522277
(1S,9S,10S,11S,20R)-9-chloro-6-hydroxy-10,20-dimethoxy-2,12,21-trioxahexacyclo[9.9.1.11,13.13,7.011,23.017,22]tricosa-3(23),4,6,13,15,17(22)-hexaene-8,18-dione (PubChem CID 132522277) has the molecular formula C22H17ClO8 and a molecular weight of 444.82 g/mol. Its IUPAC name is (1S,9S,10S,11S,20R)-9-chloro-6-hydroxy-10,20-dimethoxy-2,12,21-trioxahexacyclo[9.9.1.11,13.13,7.011,23.017,22]tricosa-3(23),4,6,13,15,17(22)-hexaene-8,18-dione.
| Compound Name | (1S,9S,10S,11S,20R)-9-chloro-6-hydroxy-10,20-dimethoxy-2,12,21-trioxahexacyclo[9.9.1.11,13.13,7.011,23.017,22]tricosa-3(23),4,6,13,15,17(22)-hexaene-8,18-dione |
|---|---|
| PubChem CID | 132522277 |
| Molecular Formula | C22H17ClO8 |
| Molecular Weight | 444.82 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | (1S,9S,10S,11S,20R)-9-chloro-6-hydroxy-10,20-dimethoxy-2,12,21-trioxahexacyclo[9.9.1.11,13.13,7.011,23.017,22]tricosa-3(23),4,6,13,15,17(22)-hexaene-8,18-dione |
| SMILES | CO[C@@H]1[C@H](Cl)C(=O)c2c(O)ccc3c2[C@@]12Oc1cccc4c1[C@](O3)(O2)[C@H](OC)CC4=O |
| InChI | InChI=1S/C22H17ClO8/c1-27-14-8-11(25)9-4-3-5-12-16(9)21(14)29-13-7-6-10(24)15-17(13)22(30-12,31-21)20(28-2)18(23)19(15)26/h3-7,14,18,20,24H,8H2,1-2H3/t14-,18-,20-,21-,22+/m1/s1 |
| InChIKey | BZDPAFWDOHFSJX-ZDAMRSHRSA-N |
| XLogP | 2.62 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.82 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|