C26H27NO7S — CID 132522769
diethyl (2R,5S)-3-methylsulfonyl-2-naphthalen-2-yl-5-phenyl-1,3-oxazolidine-4,4-dicarboxylate (PubChem CID 132522769) has the molecular formula C26H27NO7S and a molecular weight of 497.57 g/mol. Its IUPAC name is diethyl (2R,5S)-3-methylsulfonyl-2-naphthalen-2-yl-5-phenyl-1,3-oxazolidine-4,4-dicarboxylate.
| Compound Name | diethyl (2R,5S)-3-methylsulfonyl-2-naphthalen-2-yl-5-phenyl-1,3-oxazolidine-4,4-dicarboxylate |
|---|---|
| PubChem CID | 132522769 |
| Molecular Formula | C26H27NO7S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | diethyl (2R,5S)-3-methylsulfonyl-2-naphthalen-2-yl-5-phenyl-1,3-oxazolidine-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](c2ccccc2)O[C@H](c2ccc3ccccc3c2)N1S(C)(=O)=O |
| InChI | InChI=1S/C26H27NO7S/c1-4-32-24(28)26(25(29)33-5-2)22(19-12-7-6-8-13-19)34-23(27(26)35(3,30)31)21-16-15-18-11-9-10-14-20(18)17-21/h6-17,22-23H,4-5H2,1-3H3/t22-,23+/m0/s1 |
| InChIKey | VVBGDIIOKMQQBT-XZOQPEGZSA-N |
| XLogP | 3.74 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|