C17H24O4 — CID 132522954
(3aR,5S,7S,9aS)-5-hydroxy-7-methoxy-3a-methyl-1-propan-2-ylidene-3,5,6,7,9,9a-hexahydro-2H-cyclopenta[b]chromen-8-one (PubChem CID 132522954) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3aR,5S,7S,9aS)-5-hydroxy-7-methoxy-3a-methyl-1-propan-2-ylidene-3,5,6,7,9,9a-hexahydro-2H-cyclopenta[b]chromen-8-one.
| Compound Name | (3aR,5S,7S,9aS)-5-hydroxy-7-methoxy-3a-methyl-1-propan-2-ylidene-3,5,6,7,9,9a-hexahydro-2H-cyclopenta[b]chromen-8-one |
|---|---|
| PubChem CID | 132522954 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (3aR,5S,7S,9aS)-5-hydroxy-7-methoxy-3a-methyl-1-propan-2-ylidene-3,5,6,7,9,9a-hexahydro-2H-cyclopenta[b]chromen-8-one |
| SMILES | CO[C@H]1C[C@H](O)C2=C(C[C@H]3C(=C(C)C)CC[C@@]3(C)O2)C1=O |
| InChI | InChI=1S/C17H24O4/c1-9(2)10-5-6-17(3)12(10)7-11-15(19)14(20-4)8-13(18)16(11)21-17/h12-14,18H,5-8H2,1-4H3/t12-,13-,14-,17+/m0/s1 |
| InChIKey | RBASAPJSIRHPNL-AYMQEEERSA-N |
| XLogP | 2.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|