C30H31NO7S — CID 132523055
diethyl (3S,5'R)-1'-(4-methylphenyl)sulfonyl-5'-phenylspiro[1H-2-benzofuran-3,3'-pyrrolidine]-2',2'-dicarboxylate (PubChem CID 132523055) has the molecular formula C30H31NO7S and a molecular weight of 549.65 g/mol. Its IUPAC name is diethyl (3S,5'R)-1'-(4-methylphenyl)sulfonyl-5'-phenylspiro[1H-2-benzofuran-3,3'-pyrrolidine]-2',2'-dicarboxylate.
| Compound Name | diethyl (3S,5'R)-1'-(4-methylphenyl)sulfonyl-5'-phenylspiro[1H-2-benzofuran-3,3'-pyrrolidine]-2',2'-dicarboxylate |
|---|---|
| PubChem CID | 132523055 |
| Molecular Formula | C30H31NO7S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | diethyl (3S,5'R)-1'-(4-methylphenyl)sulfonyl-5'-phenylspiro[1H-2-benzofuran-3,3'-pyrrolidine]-2',2'-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N(S(=O)(=O)c2ccc(C)cc2)[C@@H](c2ccccc2)C[C@@]12OCc1ccccc12 |
| InChI | InChI=1S/C30H31NO7S/c1-4-36-27(32)30(28(33)37-5-2)29(25-14-10-9-13-23(25)20-38-29)19-26(22-11-7-6-8-12-22)31(30)39(34,35)24-17-15-21(3)16-18-24/h6-18,26H,4-5,19-20H2,1-3H3/t26-,29+/m1/s1 |
| InChIKey | DRNRUDRQTRVYRB-UHSQPCAPSA-N |
| XLogP | 4.42 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|