About 3-[(3S)-7-hydroxy-3,7-dimethyloctoxy]-2-methoxy-3-(trifluoromethyl)isoindol-1-one
3-[(3S)-7-hydroxy-3,7-dimethyloctoxy]-2-methoxy-3-(trifluoromethyl)isoindol-1-one (PubChem CID 132523299) has the molecular formula C20H28F3NO4
and a molecular weight of 403.44 g/mol. Its IUPAC name is 3-[(3S)-7-hydroxy-3,7-dimethyloctoxy]-2-methoxy-3-(trifluoromethyl)isoindol-1-one.
Molecular Properties
| Compound Name | 3-[(3S)-7-hydroxy-3,7-dimethyloctoxy]-2-methoxy-3-(trifluoromethyl)isoindol-1-one |
| PubChem CID | 132523299 |
| Molecular Formula | C20H28F3NO4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 3-[(3S)-7-hydroxy-3,7-dimethyloctoxy]-2-methoxy-3-(trifluoromethyl)isoindol-1-one |
| SMILES | CON1C(=O)c2ccccc2C1(OCC[C@@H](C)CCCC(C)(C)O)C(F)(F)F |
| InChI | InChI=1S/C20H28F3NO4/c1-14(8-7-12-18(2,3)26)11-13-28-19(20(21,22)23)16-10-6-5-9-15(16)17(25)24(19)27-4/h5-6,9-10,14,26H,7-8,11-13H2,1-4H3/t14-,19?/m0/s1 |
| InChIKey | ZBZOQJDQZQBFJM-KTQQKIMGSA-N |
| XLogP | 4.40 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3S)-7-hydroxy-3,7-dimethyloctoxy]-2-methoxy-3-(trifluoromethyl)isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3S)-7-hydroxy-3,7-dimethyloctoxy]-2-methoxy-3-(trifluoromethyl)isoindol-1-one?
The IUPAC name of 3-[(3S)-7-hydroxy-3,7-dimethyloctoxy]-2-methoxy-3-(trifluoromethyl)isoindol-1-one (CID 132523299) is 3-[(3S)-7-hydroxy-3,7-dimethyloctoxy]-2-methoxy-3-(trifluoromethyl)isoindol-1-one.
What is the SMILES notation for 3-[(3S)-7-hydroxy-3,7-dimethyloctoxy]-2-methoxy-3-(trifluoromethyl)isoindol-1-one?
The canonical SMILES for 3-[(3S)-7-hydroxy-3,7-dimethyloctoxy]-2-methoxy-3-(trifluoromethyl)isoindol-1-one is CON1C(=O)c2ccccc2C1(OCC[C@@H](C)CCCC(C)(C)O)C(F)(F)F.
What is the InChIKey of 3-[(3S)-7-hydroxy-3,7-dimethyloctoxy]-2-methoxy-3-(trifluoromethyl)isoindol-1-one?
The InChIKey is ZBZOQJDQZQBFJM-KTQQKIMGSA-N. The full InChI is InChI=1S/C20H28F3NO4/c1-14(8-7-12-18(2,3)26)11-13-28-19(20(21,22)23)16-10-6-5-9-15(16)17(25)24(19)27-4/h5-6,9-10,14,26H,7-8,11-13H2,1-4H3/t14-,19?/m0/s1.
What are the key properties of 3-[(3S)-7-hydroxy-3,7-dimethyloctoxy]-2-methoxy-3-(trifluoromethyl)isoindol-1-one?
3-[(3S)-7-hydroxy-3,7-dimethyloctoxy]-2-methoxy-3-(trifluoromethyl)isoindol-1-one has a molecular weight of 403.44 g/mol, XLogP of 4.40, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3S)-7-hydroxy-3,7-dimethyloctoxy]-2-methoxy-3-(trifluoromethyl)isoindol-1-one is sourced from PubChem (CID 132523299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).