C46H50N4O4 — CID 132523708
bis(4-phenyldiazenylphenyl) docosa-10,12-diynedioate (PubChem CID 132523708) has the molecular formula C46H50N4O4 and a molecular weight of 722.93 g/mol. Its IUPAC name is bis(4-phenyldiazenylphenyl) docosa-10,12-diynedioate.
| Compound Name | bis(4-phenyldiazenylphenyl) docosa-10,12-diynedioate |
|---|---|
| PubChem CID | 132523708 |
| Molecular Formula | C46H50N4O4 |
| Molecular Weight | 722.93 g/mol |
| Exact Mass | 722.38 |
| IUPAC Name | bis(4-phenyldiazenylphenyl) docosa-10,12-diynedioate |
| SMILES | O=C(CCCCCCCCC#CC#CCCCCCCCCC(=O)Oc1ccc(/N=N/c2ccccc2)cc1)Oc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C46H50N4O4/c51-45(53-43-35-31-41(32-36-43)49-47-39-25-19-17-20-26-39)29-23-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-24-30-46(52)54-44-37-33-42(34-38-44)50-48-40-27-21-18-22-28-40/h17-22,25-28,31-38H,5-16,23-24,29-30H2/b49-47+,50-48+ |
| InChIKey | CYSPRTDZOLOTQQ-RYZURTRPSA-N |
| XLogP | 13.28 |
| TPSA | 102.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.93 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|