C15H20O3 — CID 132524525
(1R,6R,7R,8aR)-6,7-dihydroxy-1,8a-dimethyl-7-prop-1-en-2-yl-6,8-dihydro-1H-naphthalen-2-one (PubChem CID 132524525) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1R,6R,7R,8aR)-6,7-dihydroxy-1,8a-dimethyl-7-prop-1-en-2-yl-6,8-dihydro-1H-naphthalen-2-one.
| Compound Name | (1R,6R,7R,8aR)-6,7-dihydroxy-1,8a-dimethyl-7-prop-1-en-2-yl-6,8-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 132524525 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1R,6R,7R,8aR)-6,7-dihydroxy-1,8a-dimethyl-7-prop-1-en-2-yl-6,8-dihydro-1H-naphthalen-2-one |
| SMILES | C=C(C)[C@]1(O)C[C@@]2(C)C(=C[C@H]1O)C=CC(=O)[C@@H]2C |
| InChI | InChI=1S/C15H20O3/c1-9(2)15(18)8-14(4)10(3)12(16)6-5-11(14)7-13(15)17/h5-7,10,13,17-18H,1,8H2,2-4H3/t10-,13+,14+,15+/m0/s1 |
| InChIKey | UGTYVYRNQRLCRY-CJYSPXJISA-N |
| XLogP | 1.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|