C15H24O4 — CID 132524528
(1R,2S,3S,4aR,5R,6R,7R)-4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene-1,2,6,7-tetrol (PubChem CID 132524528) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (1R,2S,3S,4aR,5R,6R,7R)-4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene-1,2,6,7-tetrol.
| Compound Name | (1R,2S,3S,4aR,5R,6R,7R)-4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene-1,2,6,7-tetrol |
|---|---|
| PubChem CID | 132524528 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (1R,2S,3S,4aR,5R,6R,7R)-4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene-1,2,6,7-tetrol |
| SMILES | C=C(C)[C@@H]1C[C@@]2(C)C(=C[C@@H](O)[C@H](O)[C@@H]2C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H24O4/c1-7(2)9-6-15(4)8(3)12(17)11(16)5-10(15)14(19)13(9)18/h5,8-9,11-14,16-19H,1,6H2,2-4H3/t8-,9-,11+,12+,13-,14+,15+/m0/s1 |
| InChIKey | NQZZOXQOZMFPKA-WBIFXTRJSA-N |
| XLogP | 0.61 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|