C7H10BrNO2 — CID 132524617
(4R)-4-[(E,1S)-1-bromobut-2-enyl]-1,3-oxazolidin-2-one (PubChem CID 132524617) has the molecular formula C7H10BrNO2 and a molecular weight of 220.07 g/mol. Its IUPAC name is (4R)-4-[(E,1S)-1-bromobut-2-enyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-[(E,1S)-1-bromobut-2-enyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 132524617 |
| Molecular Formula | C7H10BrNO2 |
| Molecular Weight | 220.07 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | (4R)-4-[(E,1S)-1-bromobut-2-enyl]-1,3-oxazolidin-2-one |
| SMILES | C/C=C/[C@H](Br)[C@H]1COC(=O)N1 |
| InChI | InChI=1S/C7H10BrNO2/c1-2-3-5(8)6-4-11-7(10)9-6/h2-3,5-6H,4H2,1H3,(H,9,10)/b3-2+/t5-,6+/m0/s1 |
| InChIKey | XISNMDKVIUXFJC-KFBNRENSSA-N |
| XLogP | 1.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.07 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|