C25H26N3O2+ — CID 132524730
21-methoxy-7,7,13-trimethyl-8-oxa-13,16-diaza-1-azoniahexacyclo[12.11.0.03,12.04,9.015,23.017,22]pentacosa-1(14),3(12),4(9),5,10,15(23),17(22),18,20-nonaene (PubChem CID 132524730) has the molecular formula C25H26N3O2+ and a molecular weight of 400.50 g/mol. Its IUPAC name is 21-methoxy-7,7,13-trimethyl-8-oxa-13,16-diaza-1-azoniahexacyclo[12.11.0.03,12.04,9.015,23.017,22]pentacosa-1(14),3(12),4(9),5,10,15(23),17(22),18,20-nonaene.
| Compound Name | 21-methoxy-7,7,13-trimethyl-8-oxa-13,16-diaza-1-azoniahexacyclo[12.11.0.03,12.04,9.015,23.017,22]pentacosa-1(14),3(12),4(9),5,10,15(23),17(22),18,20-nonaene |
|---|---|
| PubChem CID | 132524730 |
| Molecular Formula | C25H26N3O2+ |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 21-methoxy-7,7,13-trimethyl-8-oxa-13,16-diaza-1-azoniahexacyclo[12.11.0.03,12.04,9.015,23.017,22]pentacosa-1(14),3(12),4(9),5,10,15(23),17(22),18,20-nonaene |
| SMILES | COc1cccc2[nH]c3c(c12)CC[N+]1=C3N(C)c2ccc3c(c2C1)C=CC(C)(C)O3 |
| InChI | InChI=1S/C25H25N3O2/c1-25(2)12-10-15-17-14-28-13-11-16-22-18(6-5-7-21(22)29-4)26-23(16)24(28)27(3)19(17)8-9-20(15)30-25/h5-10,12H,11,13-14H2,1-4H3/p+1 |
| InChIKey | VTJFYSWECDCFHP-UHFFFAOYSA-O |
| XLogP | 4.33 |
| TPSA | 40.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|