C15H27ClO5 — CID 132524983
(2S,3R,4S,4aS,6R,8S,8aS)-8-chloro-2,3,4-trimethoxy-6-(2-methylpropyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran (PubChem CID 132524983) has the molecular formula C15H27ClO5 and a molecular weight of 322.83 g/mol. Its IUPAC name is (2S,3R,4S,4aS,6R,8S,8aS)-8-chloro-2,3,4-trimethoxy-6-(2-methylpropyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran.
| Compound Name | (2S,3R,4S,4aS,6R,8S,8aS)-8-chloro-2,3,4-trimethoxy-6-(2-methylpropyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 132524983 |
| Molecular Formula | C15H27ClO5 |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (2S,3R,4S,4aS,6R,8S,8aS)-8-chloro-2,3,4-trimethoxy-6-(2-methylpropyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
| SMILES | CO[C@H]1O[C@H]2[C@@H](O[C@H](CC(C)C)C[C@@H]2Cl)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C15H27ClO5/c1-8(2)6-9-7-10(16)11-13(20-9)12(17-3)14(18-4)15(19-5)21-11/h8-15H,6-7H2,1-5H3/t9-,10+,11-,12+,13-,14-,15+/m1/s1 |
| InChIKey | CPUMGWZGVILZRR-LJJRGKOZSA-N |
| XLogP | 2.20 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|