C15H23BrO2 — CID 132525080
(3S,4S,6S,9R)-4-bromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,10-diene-3,9-diol (PubChem CID 132525080) has the molecular formula C15H23BrO2 and a molecular weight of 315.25 g/mol. Its IUPAC name is (3S,4S,6S,9R)-4-bromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,10-diene-3,9-diol.
| Compound Name | (3S,4S,6S,9R)-4-bromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,10-diene-3,9-diol |
|---|---|
| PubChem CID | 132525080 |
| Molecular Formula | C15H23BrO2 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (3S,4S,6S,9R)-4-bromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,10-diene-3,9-diol |
| SMILES | CC1=C[C@H](O)[C@@H](Br)C(C)(C)[C@@]12C=C[C@](C)(O)CC2 |
| InChI | InChI=1S/C15H23BrO2/c1-10-9-11(17)12(16)13(2,3)15(10)7-5-14(4,18)6-8-15/h5,7,9,11-12,17-18H,6,8H2,1-4H3/t11-,12+,14-,15+/m0/s1 |
| InChIKey | HFOHBOJAMAWSIQ-MYZSUADSSA-N |
| XLogP | 3.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|