C28H30O10 — CID 132525313
1-[3-[[(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-6-yl]methyl]-2,4-dihydroxy-6-methoxy-5-methylphenyl]butan-1-one (PubChem CID 132525313) has the molecular formula C28H30O10 and a molecular weight of 526.54 g/mol. Its IUPAC name is 1-[3-[[(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-6-yl]methyl]-2,4-dihydroxy-6-methoxy-5-methylphenyl]butan-1-one.
| Compound Name | 1-[3-[[(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-6-yl]methyl]-2,4-dihydroxy-6-methoxy-5-methylphenyl]butan-1-one |
|---|---|
| PubChem CID | 132525313 |
| Molecular Formula | C28H30O10 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 1-[3-[[(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-6-yl]methyl]-2,4-dihydroxy-6-methoxy-5-methylphenyl]butan-1-one |
| SMILES | CCCC(=O)c1c(O)c(Cc2c(O)cc3c(c2O)C[C@H](O)[C@@H](c2ccc(O)c(O)c2)O3)c(O)c(C)c1OC |
| InChI | InChI=1S/C28H30O10/c1-4-5-18(30)23-26(36)16(24(34)12(2)27(23)37-3)9-14-19(31)11-22-15(25(14)35)10-21(33)28(38-22)13-6-7-17(29)20(32)8-13/h6-8,11,21,28-29,31-36H,4-5,9-10H2,1-3H3/t21-,28+/m0/s1 |
| InChIKey | LDZRRAPALZTNDJ-RBTNQOKQSA-N |
| XLogP | 3.85 |
| TPSA | 177.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|