C45H80NNaO14S — CID 132525346
sodium [(8S,9S,10R,15S,23S,25R)-8,9,10-triacetyloxy-23-hydroxy-1-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-25-methyl-1-oxodotriacontan-15-yl] sulfate (PubChem CID 132525346) has the molecular formula C45H80NNaO14S and a molecular weight of 914.18 g/mol. Its IUPAC name is sodium [(8S,9S,10R,15S,23S,25R)-8,9,10-triacetyloxy-23-hydroxy-1-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-25-methyl-1-oxodotriacontan-15-yl] sulfate.
| Compound Name | sodium [(8S,9S,10R,15S,23S,25R)-8,9,10-triacetyloxy-23-hydroxy-1-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-25-methyl-1-oxodotriacontan-15-yl] sulfate |
|---|---|
| PubChem CID | 132525346 |
| Molecular Formula | C45H80NNaO14S |
| Molecular Weight | 914.18 g/mol |
| Exact Mass | 913.52 |
| IUPAC Name | sodium [(8S,9S,10R,15S,23S,25R)-8,9,10-triacetyloxy-23-hydroxy-1-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-25-methyl-1-oxodotriacontan-15-yl] sulfate |
| SMILES | CCCCCCC[C@@H](C)C[C@@H](O)CCCCCCC[C@@H](CCCC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](CCCCCCC(=O)N1CCC[C@H]1C(=O)OC)OC(C)=O)OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C45H81NO14S.Na/c1-7-8-9-11-16-24-34(2)33-38(50)25-17-12-10-13-18-26-39(60-61(53,54)55)27-21-22-30-42(58-36(4)48)44(59-37(5)49)41(57-35(3)47)29-19-14-15-20-31-43(51)46-32-23-28-40(46)45(52)56-6;/h34,38-42,44,50H,7-33H2,1-6H3,(H,53,54,55);/q;+1/p-1/t34-,38+,39+,40+,41+,42-,44+;/m1./s1 |
| InChIKey | ODIHCSCXFUZXQP-COARUEDESA-M |
| XLogP | 5.17 |
| TPSA | 212.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.18 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|