C45H81NO14S — CID 132525347
methyl (2S)-1-[(8S,9S,10R,15S,23S,25R)-8,9,10-triacetyloxy-23-hydroxy-25-methyl-15-sulfooxydotriacontanoyl]pyrrolidine-2-carboxylate (PubChem CID 132525347) has the molecular formula C45H81NO14S and a molecular weight of 892.20 g/mol. Its IUPAC name is methyl (2S)-1-[(8S,9S,10R,15S,23S,25R)-8,9,10-triacetyloxy-23-hydroxy-25-methyl-15-sulfooxydotriacontanoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(8S,9S,10R,15S,23S,25R)-8,9,10-triacetyloxy-23-hydroxy-25-methyl-15-sulfooxydotriacontanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 132525347 |
| Molecular Formula | C45H81NO14S |
| Molecular Weight | 892.20 g/mol |
| Exact Mass | 891.54 |
| IUPAC Name | methyl (2S)-1-[(8S,9S,10R,15S,23S,25R)-8,9,10-triacetyloxy-23-hydroxy-25-methyl-15-sulfooxydotriacontanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCCC[C@@H](C)C[C@@H](O)CCCCCCC[C@@H](CCCC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](CCCCCCC(=O)N1CCC[C@H]1C(=O)OC)OC(C)=O)OS(=O)(=O)O |
| InChI | InChI=1S/C45H81NO14S/c1-7-8-9-11-16-24-34(2)33-38(50)25-17-12-10-13-18-26-39(60-61(53,54)55)27-21-22-30-42(58-36(4)48)44(59-37(5)49)41(57-35(3)47)29-19-14-15-20-31-43(51)46-32-23-28-40(46)45(52)56-6/h34,38-42,44,50H,7-33H2,1-6H3,(H,53,54,55)/t34-,38+,39+,40+,41+,42-,44+/m1/s1 |
| InChIKey | XQVYEGOQNZVKPV-YJDXKRNDSA-N |
| XLogP | 8.51 |
| TPSA | 209.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.20 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|