C43H76NNaO14S — CID 132525348
sodium [(7R,8R,21R,22S,23S)-21,22,23-triacetyloxy-16-hydroxy-30-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-7-methyl-30-oxotriacontan-8-yl] sulfate (PubChem CID 132525348) has the molecular formula C43H76NNaO14S and a molecular weight of 886.13 g/mol. Its IUPAC name is sodium [(7R,8R,21R,22S,23S)-21,22,23-triacetyloxy-16-hydroxy-30-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-7-methyl-30-oxotriacontan-8-yl] sulfate.
| Compound Name | sodium [(7R,8R,21R,22S,23S)-21,22,23-triacetyloxy-16-hydroxy-30-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-7-methyl-30-oxotriacontan-8-yl] sulfate |
|---|---|
| PubChem CID | 132525348 |
| Molecular Formula | C43H76NNaO14S |
| Molecular Weight | 886.13 g/mol |
| Exact Mass | 885.49 |
| IUPAC Name | sodium [(7R,8R,21R,22S,23S)-21,22,23-triacetyloxy-16-hydroxy-30-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-7-methyl-30-oxotriacontan-8-yl] sulfate |
| SMILES | CCCCCC[C@@H](C)[C@@H](CCCCCCCC(O)CCCC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](CCCCCCC(=O)N1CCC[C@H]1C(=O)OC)OC(C)=O)OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C43H77NO14S.Na/c1-7-8-9-15-23-32(2)38(58-59(51,52)53)27-17-12-10-11-16-24-36(48)25-20-21-29-40(56-34(4)46)42(57-35(5)47)39(55-33(3)45)28-18-13-14-19-30-41(49)44-31-22-26-37(44)43(50)54-6;/h32,36-40,42,48H,7-31H2,1-6H3,(H,51,52,53);/q;+1/p-1/t32-,36?,37+,38-,39+,40-,42+;/m1./s1 |
| InChIKey | VSGBJFWPVDQUPK-FNJZEIMISA-M |
| XLogP | 4.39 |
| TPSA | 212.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.13 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|