C10H18O6 — CID 132525535
(4S,6S)-6-[(1S,2R)-1,2-dihydroxybutyl]-4-hydroxy-4-methoxyoxan-2-one (PubChem CID 132525535) has the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. Its IUPAC name is (4S,6S)-6-[(1S,2R)-1,2-dihydroxybutyl]-4-hydroxy-4-methoxyoxan-2-one.
| Compound Name | (4S,6S)-6-[(1S,2R)-1,2-dihydroxybutyl]-4-hydroxy-4-methoxyoxan-2-one |
|---|---|
| PubChem CID | 132525535 |
| Molecular Formula | C10H18O6 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (4S,6S)-6-[(1S,2R)-1,2-dihydroxybutyl]-4-hydroxy-4-methoxyoxan-2-one |
| SMILES | CC[C@@H](O)[C@H](O)[C@@H]1C[C@](O)(OC)CC(=O)O1 |
| InChI | InChI=1S/C10H18O6/c1-3-6(11)9(13)7-4-10(14,15-2)5-8(12)16-7/h6-7,9,11,13-14H,3-5H2,1-2H3/t6-,7+,9+,10+/m1/s1 |
| InChIKey | MRRWNBJIBVDCET-KKHAAJSZSA-N |
| XLogP | -0.84 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|