C18H24O8 — CID 132526033
[(E)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enyl] benzoate (PubChem CID 132526033) has the molecular formula C18H24O8 and a molecular weight of 368.38 g/mol. Its IUPAC name is [(E)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enyl] benzoate.
| Compound Name | [(E)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enyl] benzoate |
|---|---|
| PubChem CID | 132526033 |
| Molecular Formula | C18H24O8 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [(E)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enyl] benzoate |
| SMILES | C/C(=C\COC(=O)c1ccccc1)CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H24O8/c1-11(7-8-24-17(23)12-5-3-2-4-6-12)10-25-18-16(22)15(21)14(20)13(9-19)26-18/h2-7,13-16,18-22H,8-10H2,1H3/b11-7+/t13-,14-,15+,16-,18-/m1/s1 |
| InChIKey | RKGXITCTNQJXRZ-NBXQZZMVSA-N |
| XLogP | -0.39 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|