C20H32 — CID 132526301
(3R,3aS,5aS,8aR,10aR,10bS,10cS)-3,5a,8a-trimethyl-10-methylidene-2,3,3a,4,5,6,7,8,9,10a,10b,10c-dodecahydro-1H-pyrene (PubChem CID 132526301) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (3R,3aS,5aS,8aR,10aR,10bS,10cS)-3,5a,8a-trimethyl-10-methylidene-2,3,3a,4,5,6,7,8,9,10a,10b,10c-dodecahydro-1H-pyrene.
| Compound Name | (3R,3aS,5aS,8aR,10aR,10bS,10cS)-3,5a,8a-trimethyl-10-methylidene-2,3,3a,4,5,6,7,8,9,10a,10b,10c-dodecahydro-1H-pyrene |
|---|---|
| PubChem CID | 132526301 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (3R,3aS,5aS,8aR,10aR,10bS,10cS)-3,5a,8a-trimethyl-10-methylidene-2,3,3a,4,5,6,7,8,9,10a,10b,10c-dodecahydro-1H-pyrene |
| SMILES | C=C1C[C@@]2(C)CCC[C@@]3(C)CC[C@@H]4[C@H]([C@@H]32)[C@H]1CC[C@H]4C |
| InChI | InChI=1S/C20H32/c1-13-6-7-15-14(2)12-20(4)10-5-9-19(3)11-8-16(13)17(15)18(19)20/h13,15-18H,2,5-12H2,1,3-4H3/t13-,15+,16+,17-,18+,19+,20-/m1/s1 |
| InChIKey | SRSMHCPRTXUJJM-KAHIACEGSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|