C40H26N4O6 — CID 132526621
4-[10,15-bis(4-carboxyphenyl)-23,24-dihydro-21H-corrin-5-yl]benzoic acid (PubChem CID 132526621) has the molecular formula C40H26N4O6 and a molecular weight of 658.67 g/mol. Its IUPAC name is 4-[10,15-bis(4-carboxyphenyl)-23,24-dihydro-21H-corrin-5-yl]benzoic acid.
| Compound Name | 4-[10,15-bis(4-carboxyphenyl)-23,24-dihydro-21H-corrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 132526621 |
| Molecular Formula | C40H26N4O6 |
| Molecular Weight | 658.67 g/mol |
| Exact Mass | 658.19 |
| IUPAC Name | 4-[10,15-bis(4-carboxyphenyl)-23,24-dihydro-21H-corrin-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c3nc(c(-c4ccc(C(=O)O)cc4)c4ccc([nH]4)c4ccc([nH]4)c(-c4ccc(C(=O)O)cc4)c4ccc2[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C40H26N4O6/c45-38(46)24-7-1-21(2-8-24)35-29-15-13-27(41-29)28-14-16-30(42-28)36(22-3-9-25(10-4-22)39(47)48)32-18-20-34(44-32)37(33-19-17-31(35)43-33)23-5-11-26(12-6-23)40(49)50/h1-20,41-43H,(H,45,46)(H,47,48)(H,49,50)/b28-27-,35-29-,35-31-,36-30-,36-32-,37-33-,37-34- |
| InChIKey | IHNBNOQYIVYYJS-BXDIYPIMSA-N |
| XLogP | 8.79 |
| TPSA | 172.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.67 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |