C15H22O5 — CID 132526754
(2S,4aS,5R,6R,8aR)-6-hydroxy-5-(3-hydroxypropanoyl)-6-methyl-2,3,4,4a,5,8a-hexahydro-1H-naphthalene-2-carboxylic acid (PubChem CID 132526754) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (2S,4aS,5R,6R,8aR)-6-hydroxy-5-(3-hydroxypropanoyl)-6-methyl-2,3,4,4a,5,8a-hexahydro-1H-naphthalene-2-carboxylic acid.
| Compound Name | (2S,4aS,5R,6R,8aR)-6-hydroxy-5-(3-hydroxypropanoyl)-6-methyl-2,3,4,4a,5,8a-hexahydro-1H-naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 132526754 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (2S,4aS,5R,6R,8aR)-6-hydroxy-5-(3-hydroxypropanoyl)-6-methyl-2,3,4,4a,5,8a-hexahydro-1H-naphthalene-2-carboxylic acid |
| SMILES | C[C@@]1(O)C=C[C@H]2C[C@@H](C(=O)O)CC[C@@H]2[C@H]1C(=O)CCO |
| InChI | InChI=1S/C15H22O5/c1-15(20)6-4-9-8-10(14(18)19)2-3-11(9)13(15)12(17)5-7-16/h4,6,9-11,13,16,20H,2-3,5,7-8H2,1H3,(H,18,19)/t9-,10-,11-,13-,15+/m0/s1 |
| InChIKey | LANNQBKRPTYEAU-MAWRTODSSA-N |
| XLogP | 0.99 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|