C17H28O6 — CID 132526757
[3-[(1R,2S,3R,4S,4aS,6S,8aS)-2,3,4-trihydroxy-2,6-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl]-3-oxopropyl] acetate (PubChem CID 132526757) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is [3-[(1R,2S,3R,4S,4aS,6S,8aS)-2,3,4-trihydroxy-2,6-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl]-3-oxopropyl] acetate.
| Compound Name | [3-[(1R,2S,3R,4S,4aS,6S,8aS)-2,3,4-trihydroxy-2,6-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl]-3-oxopropyl] acetate |
|---|---|
| PubChem CID | 132526757 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [3-[(1R,2S,3R,4S,4aS,6S,8aS)-2,3,4-trihydroxy-2,6-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl]-3-oxopropyl] acetate |
| SMILES | CC(=O)OCCC(=O)[C@@H]1[C@H]2CC[C@H](C)C[C@@H]2[C@H](O)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C17H28O6/c1-9-4-5-11-12(8-9)15(20)16(21)17(3,22)14(11)13(19)6-7-23-10(2)18/h9,11-12,14-16,20-22H,4-8H2,1-3H3/t9-,11-,12-,14-,15-,16+,17-/m0/s1 |
| InChIKey | FVWHCISSWMJCBI-YSOYJNHBSA-N |
| XLogP | 0.66 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |