C17H26O5 — CID 132526758
[3-[(1R,4R,4aR,5R,6S,8aS)-4,5-dihydroxy-2,6-dimethyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-oxopropyl] acetate (PubChem CID 132526758) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is [3-[(1R,4R,4aR,5R,6S,8aS)-4,5-dihydroxy-2,6-dimethyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-oxopropyl] acetate.
| Compound Name | [3-[(1R,4R,4aR,5R,6S,8aS)-4,5-dihydroxy-2,6-dimethyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-oxopropyl] acetate |
|---|---|
| PubChem CID | 132526758 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [3-[(1R,4R,4aR,5R,6S,8aS)-4,5-dihydroxy-2,6-dimethyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-oxopropyl] acetate |
| SMILES | CC(=O)OCCC(=O)[C@H]1C(C)=C[C@@H](O)[C@H]2[C@H](O)[C@@H](C)CC[C@H]12 |
| InChI | InChI=1S/C17H26O5/c1-9-4-5-12-15(13(19)6-7-22-11(3)18)10(2)8-14(20)16(12)17(9)21/h8-9,12,14-17,20-21H,4-7H2,1-3H3/t9-,12+,14+,15-,16-,17+/m0/s1 |
| InChIKey | RGBHJOOHGLFPBD-SYQTUFFBSA-N |
| XLogP | 1.47 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|