C28H34O10 — CID 132526812
[(1S,2R,5R,6R,7S,8R,9R,12R)-5,8,12-triacetyloxy-2,6,10,10-tetramethyl-4-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate (PubChem CID 132526812) has the molecular formula C28H34O10 and a molecular weight of 530.57 g/mol. Its IUPAC name is [(1S,2R,5R,6R,7S,8R,9R,12R)-5,8,12-triacetyloxy-2,6,10,10-tetramethyl-4-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate.
| Compound Name | [(1S,2R,5R,6R,7S,8R,9R,12R)-5,8,12-triacetyloxy-2,6,10,10-tetramethyl-4-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate |
|---|---|
| PubChem CID | 132526812 |
| Molecular Formula | C28H34O10 |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | [(1S,2R,5R,6R,7S,8R,9R,12R)-5,8,12-triacetyloxy-2,6,10,10-tetramethyl-4-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2[C@@H](OC(C)=O)[C@]3(OC2(C)C)[C@H](C)CC(=O)[C@H](OC(C)=O)[C@@]3(C)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H34O10/c1-14-13-19(32)22(35-16(3)30)27(7)24(37-25(33)18-11-9-8-10-12-18)21(34-15(2)29)20-23(36-17(4)31)28(14,27)38-26(20,5)6/h8-12,14,20-24H,13H2,1-7H3/t14-,20-,21-,22+,23-,24-,27+,28-/m1/s1 |
| InChIKey | KVQJNLUVMJNRON-XBHLUESWSA-N |
| XLogP | 2.80 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|