About (4R)-1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene
(4R)-1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene (PubChem CID 13252682) has the molecular formula C15H24
and a molecular weight of 204.36 g/mol. Its IUPAC name is (4R)-1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene.
Molecular Properties
| Compound Name | (4R)-1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene |
| PubChem CID | 13252682 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (4R)-1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene |
| SMILES | CC(C)=CC/C=C(\C)[C@H]1CC=C(C)CC1 |
| InChI | InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6-8,15H,5,9-11H2,1-4H3/b14-7+/t15-/m0/s1 |
| InChIKey | YHBUQBJHSRGZNF-LULHVWEPSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene?
The IUPAC name of (4R)-1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene (CID 13252682) is (4R)-1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene.
What is the SMILES notation for (4R)-1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene?
The canonical SMILES for (4R)-1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene is CC(C)=CC/C=C(\C)[C@H]1CC=C(C)CC1.
What is the InChIKey of (4R)-1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene?
The InChIKey is YHBUQBJHSRGZNF-LULHVWEPSA-N. The full InChI is InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6-8,15H,5,9-11H2,1-4H3/b14-7+/t15-/m0/s1.
What are the key properties of (4R)-1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene?
(4R)-1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene has a molecular weight of 204.36 g/mol, XLogP of 5.04, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene is sourced from PubChem (CID 13252682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).