C13H9F3N2O3 — CID 132526893
3-methyl-4-nitro-5-[(Z)-3,3,3-trifluoro-2-phenylprop-1-enyl]-1,2-oxazole (PubChem CID 132526893) has the molecular formula C13H9F3N2O3 and a molecular weight of 298.22 g/mol. Its IUPAC name is 3-methyl-4-nitro-5-[(Z)-3,3,3-trifluoro-2-phenylprop-1-enyl]-1,2-oxazole.
| Compound Name | 3-methyl-4-nitro-5-[(Z)-3,3,3-trifluoro-2-phenylprop-1-enyl]-1,2-oxazole |
|---|---|
| PubChem CID | 132526893 |
| Molecular Formula | C13H9F3N2O3 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 3-methyl-4-nitro-5-[(Z)-3,3,3-trifluoro-2-phenylprop-1-enyl]-1,2-oxazole |
| SMILES | Cc1noc(/C=C(/c2ccccc2)C(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9F3N2O3/c1-8-12(18(19)20)11(21-17-8)7-10(13(14,15)16)9-5-3-2-4-6-9/h2-7H,1H3/b10-7- |
| InChIKey | XUDUSYKDVVTHTK-YFHOEESVSA-N |
| XLogP | 3.99 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|