C14H12F3N3O5 — CID 132526894
3-methyl-4-nitro-5-[3,3,3-trifluoro-2-(nitromethyl)-2-phenylpropyl]-1,2-oxazole (PubChem CID 132526894) has the molecular formula C14H12F3N3O5 and a molecular weight of 359.26 g/mol. Its IUPAC name is 3-methyl-4-nitro-5-[3,3,3-trifluoro-2-(nitromethyl)-2-phenylpropyl]-1,2-oxazole.
| Compound Name | 3-methyl-4-nitro-5-[3,3,3-trifluoro-2-(nitromethyl)-2-phenylpropyl]-1,2-oxazole |
|---|---|
| PubChem CID | 132526894 |
| Molecular Formula | C14H12F3N3O5 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 3-methyl-4-nitro-5-[3,3,3-trifluoro-2-(nitromethyl)-2-phenylpropyl]-1,2-oxazole |
| SMILES | Cc1noc(CC(C[N+](=O)[O-])(c2ccccc2)C(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12F3N3O5/c1-9-12(20(23)24)11(25-18-9)7-13(8-19(21)22,14(15,16)17)10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| InChIKey | TVYRQRJJQDWUMS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 112.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|